C12H8N2O2S — CID 90929948
3λ6-thia-8,14-diazatricyclo[9.4.0.02,7]pentadeca-1,4,6,8,10,12,14-heptaene 3,3-dioxide (PubChem CID 90929948) has the molecular formula C12H8N2O2S and a molecular weight of 244.28 g/mol. Its IUPAC name is 3λ6-thia-8,14-diazatricyclo[9.4.0.02,7]pentadeca-1,4,6,8,10,12,14-heptaene 3,3-dioxide.
| Compound Name | 3λ6-thia-8,14-diazatricyclo[9.4.0.02,7]pentadeca-1,4,6,8,10,12,14-heptaene 3,3-dioxide |
|---|---|
| PubChem CID | 90929948 |
| Molecular Formula | C12H8N2O2S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 3λ6-thia-8,14-diazatricyclo[9.4.0.02,7]pentadeca-1,4,6,8,10,12,14-heptaene 3,3-dioxide |
| SMILES | O=S1(=O)C=CC=C2N=CC=c3ccncc3=C21 |
| InChI | InChI=1S/C12H8N2O2S/c15-17(16)7-1-2-11-12(17)10-8-13-5-3-9(10)4-6-14-11/h1-8H |
| InChIKey | CNRSVPVXDKLCPJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |