C14H11N5O3S — CID 90929998
carbamoyl 2-(pyridin-3-ylmethylamino)thieno[3,2-d]pyrimidine-4-carboxylate (PubChem CID 90929998) has the molecular formula C14H11N5O3S and a molecular weight of 329.34 g/mol. Its IUPAC name is carbamoyl 2-(pyridin-3-ylmethylamino)thieno[3,2-d]pyrimidine-4-carboxylate.
| Compound Name | carbamoyl 2-(pyridin-3-ylmethylamino)thieno[3,2-d]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 90929998 |
| Molecular Formula | C14H11N5O3S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | carbamoyl 2-(pyridin-3-ylmethylamino)thieno[3,2-d]pyrimidine-4-carboxylate |
| SMILES | NC(=O)OC(=O)c1nc(NCc2cccnc2)nc2ccsc12 |
| InChI | InChI=1S/C14H11N5O3S/c15-13(21)22-12(20)10-11-9(3-5-23-11)18-14(19-10)17-7-8-2-1-4-16-6-8/h1-6H,7H2,(H2,15,21)(H,17,18,19) |
| InChIKey | BHZLUNSPAXEHOM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|