C26H20FN5O3 — CID 90930043
(5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-[4-(1-methylindazol-5-yl)phenyl]imidazolidine-2,4-dione (PubChem CID 90930043) has the molecular formula C26H20FN5O3 and a molecular weight of 469.48 g/mol. Its IUPAC name is (5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-[4-(1-methylindazol-5-yl)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-[4-(1-methylindazol-5-yl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90930043 |
| Molecular Formula | C26H20FN5O3 |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | (5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-[4-(1-methylindazol-5-yl)phenyl]imidazolidine-2,4-dione |
| SMILES | Cn1ncc2cc(-c3ccc([C@]4(Cn5cc6ccc(F)cc6c5O)NC(=O)NC4=O)cc3)ccc21 |
| InChI | InChI=1S/C26H20FN5O3/c1-31-22-9-5-16(10-18(22)12-28-31)15-2-6-19(7-3-15)26(24(34)29-25(35)30-26)14-32-13-17-4-8-20(27)11-21(17)23(32)33/h2-13,33H,14H2,1H3,(H2,29,30,34,35)/t26-/m0/s1 |
| InChIKey | HORRAEKBPQVKBA-SANMLTNESA-N |
| XLogP | 3.77 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|