C15H20O6S — CID 90930082
methyl (1S,3S,5S)-3-hydroxy-5-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate (PubChem CID 90930082) has the molecular formula C15H20O6S and a molecular weight of 328.39 g/mol. Its IUPAC name is methyl (1S,3S,5S)-3-hydroxy-5-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate.
| Compound Name | methyl (1S,3S,5S)-3-hydroxy-5-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90930082 |
| Molecular Formula | C15H20O6S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | methyl (1S,3S,5S)-3-hydroxy-5-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H](O)C[C@@H](OS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C15H20O6S/c1-10-3-5-14(6-4-10)22(18,19)21-13-8-11(15(17)20-2)7-12(16)9-13/h3-6,11-13,16H,7-9H2,1-2H3/t11-,12-,13-/m0/s1 |
| InChIKey | JITHOIDNPRRFQI-AVGNSLFASA-N |
| XLogP | 1.40 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|