C23H32P2 — CID 90930140
(7R,11S)-5,6,7,9,9,11,12,13,14,15-decamethyl-1,4-diphosphapentacyclo[9.2.1.14,7.02,10.03,8]pentadeca-2(10),3(8),5,12-tetraene (PubChem CID 90930140) has the molecular formula C23H32P2 and a molecular weight of 370.46 g/mol. Its IUPAC name is (7R,11S)-5,6,7,9,9,11,12,13,14,15-decamethyl-1,4-diphosphapentacyclo[9.2.1.14,7.02,10.03,8]pentadeca-2(10),3(8),5,12-tetraene.
| Compound Name | (7R,11S)-5,6,7,9,9,11,12,13,14,15-decamethyl-1,4-diphosphapentacyclo[9.2.1.14,7.02,10.03,8]pentadeca-2(10),3(8),5,12-tetraene |
|---|---|
| PubChem CID | 90930140 |
| Molecular Formula | C23H32P2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (7R,11S)-5,6,7,9,9,11,12,13,14,15-decamethyl-1,4-diphosphapentacyclo[9.2.1.14,7.02,10.03,8]pentadeca-2(10),3(8),5,12-tetraene |
| SMILES | CC1=C(C)[C@@]2(C)C3=C(C4=C(C3(C)C)[C@@]3(C)C(C)=C(C)P4C3C)P1C2C |
| InChI | InChI=1S/C23H32P2/c1-11-13(3)24-15(5)22(11,9)19-17(24)18-20(21(19,7)8)23(10)12(2)14(4)25(18)16(23)6/h15-16H,1-10H3/t15?,16?,22-,23+,24?,25? |
| InChIKey | CFBZPGQOTXSBSQ-AEEXYSJESA-N |
| XLogP | 7.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|