About 6-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine
6-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine (PubChem CID 90930168) has the molecular formula C11H12FN
and a molecular weight of 177.22 g/mol. Its IUPAC name is 6-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 6-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine |
| PubChem CID | 90930168 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 6-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine |
| SMILES | C=C(F)/C=C\C(=C)C1=CCCC=N1 |
| InChI | InChI=1S/C11H12FN/c1-9(6-7-10(2)12)11-5-3-4-8-13-11/h5-8H,1-4H2/b7-6- |
| InChIKey | HGSQRRISCWRHCX-SREVYHEPSA-N |
| XLogP | 3.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine?
The IUPAC name of 6-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine (CID 90930168) is 6-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine.
What is the SMILES notation for 6-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine?
The canonical SMILES for 6-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine is C=C(F)/C=C\C(=C)C1=CCCC=N1.
What is the InChIKey of 6-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine?
The InChIKey is HGSQRRISCWRHCX-SREVYHEPSA-N. The full InChI is InChI=1S/C11H12FN/c1-9(6-7-10(2)12)11-5-3-4-8-13-11/h5-8H,1-4H2/b7-6-.
What are the key properties of 6-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine?
6-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine has a molecular weight of 177.22 g/mol, XLogP of 3.33, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine is sourced from PubChem (CID 90930168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).