About 4-[[2,7-dibromo-9-(pyridin-4-ylmethyl)fluoren-9-yl]methyl]pyridine
4-[[2,7-dibromo-9-(pyridin-4-ylmethyl)fluoren-9-yl]methyl]pyridine (PubChem CID 90930230) has the molecular formula C25H18Br2N2
and a molecular weight of 506.24 g/mol. Its IUPAC name is 4-[[2,7-dibromo-9-(pyridin-4-ylmethyl)fluoren-9-yl]methyl]pyridine.
Molecular Properties
| Compound Name | 4-[[2,7-dibromo-9-(pyridin-4-ylmethyl)fluoren-9-yl]methyl]pyridine |
| PubChem CID | 90930230 |
| Molecular Formula | C25H18Br2N2 |
| Molecular Weight | 506.24 g/mol |
| Exact Mass | 503.98 |
| IUPAC Name | 4-[[2,7-dibromo-9-(pyridin-4-ylmethyl)fluoren-9-yl]methyl]pyridine |
| SMILES | Brc1ccc2c(c1)C(Cc1ccncc1)(Cc1ccncc1)c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C25H18Br2N2/c26-19-1-3-21-22-4-2-20(27)14-24(22)25(23(21)13-19,15-17-5-9-28-10-6-17)16-18-7-11-29-12-8-18/h1-14H,15-16H2 |
| InChIKey | HCBTZMNDLMUABP-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.24 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[[2,7-dibromo-9-(pyridin-4-ylmethyl)fluoren-9-yl]methyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2,7-dibromo-9-(pyridin-4-ylmethyl)fluoren-9-yl]methyl]pyridine?
The IUPAC name of 4-[[2,7-dibromo-9-(pyridin-4-ylmethyl)fluoren-9-yl]methyl]pyridine (CID 90930230) is 4-[[2,7-dibromo-9-(pyridin-4-ylmethyl)fluoren-9-yl]methyl]pyridine.
What is the SMILES notation for 4-[[2,7-dibromo-9-(pyridin-4-ylmethyl)fluoren-9-yl]methyl]pyridine?
The canonical SMILES for 4-[[2,7-dibromo-9-(pyridin-4-ylmethyl)fluoren-9-yl]methyl]pyridine is Brc1ccc2c(c1)C(Cc1ccncc1)(Cc1ccncc1)c1cc(Br)ccc1-2.
What is the InChIKey of 4-[[2,7-dibromo-9-(pyridin-4-ylmethyl)fluoren-9-yl]methyl]pyridine?
The InChIKey is HCBTZMNDLMUABP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18Br2N2/c26-19-1-3-21-22-4-2-20(27)14-24(22)25(23(21)13-19,15-17-5-9-28-10-6-17)16-18-7-11-29-12-8-18/h1-14H,15-16H2.
What are the key properties of 4-[[2,7-dibromo-9-(pyridin-4-ylmethyl)fluoren-9-yl]methyl]pyridine?
4-[[2,7-dibromo-9-(pyridin-4-ylmethyl)fluoren-9-yl]methyl]pyridine has a molecular weight of 506.24 g/mol, XLogP of 6.75, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2,7-dibromo-9-(pyridin-4-ylmethyl)fluoren-9-yl]methyl]pyridine is sourced from PubChem (CID 90930230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).