C18H12FN3O — CID 90930401
3-(4-fluorophenyl)-1-hydroxy-2-pyridin-2-ylpyrrolo[3,2-b]pyridine (PubChem CID 90930401) has the molecular formula C18H12FN3O and a molecular weight of 305.31 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-hydroxy-2-pyridin-2-ylpyrrolo[3,2-b]pyridine.
| Compound Name | 3-(4-fluorophenyl)-1-hydroxy-2-pyridin-2-ylpyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 90930401 |
| Molecular Formula | C18H12FN3O |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 3-(4-fluorophenyl)-1-hydroxy-2-pyridin-2-ylpyrrolo[3,2-b]pyridine |
| SMILES | On1c(-c2ccccn2)c(-c2ccc(F)cc2)c2ncccc21 |
| InChI | InChI=1S/C18H12FN3O/c19-13-8-6-12(7-9-13)16-17-15(5-3-11-21-17)22(23)18(16)14-4-1-2-10-20-14/h1-11,23H |
| InChIKey | PYTPVHPZOOFVLM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|