About 2,2-dimethyl-1,3-dihydroindole;ethane
2,2-dimethyl-1,3-dihydroindole;ethane (PubChem CID 90930598) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dihydroindole;ethane.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,3-dihydroindole;ethane |
| PubChem CID | 90930598 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 2,2-dimethyl-1,3-dihydroindole;ethane |
| SMILES | CC.CC1(C)Cc2ccccc2N1 |
| InChI | InChI=1S/C10H13N.C2H6/c1-10(2)7-8-5-3-4-6-9(8)11-10;1-2/h3-6,11H,7H2,1-2H3;1-2H3 |
| InChIKey | CZRLTEAMJXPLKL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dimethyl-1,3-dihydroindole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,3-dihydroindole;ethane?
The IUPAC name of 2,2-dimethyl-1,3-dihydroindole;ethane (CID 90930598) is 2,2-dimethyl-1,3-dihydroindole;ethane.
What is the SMILES notation for 2,2-dimethyl-1,3-dihydroindole;ethane?
The canonical SMILES for 2,2-dimethyl-1,3-dihydroindole;ethane is CC.CC1(C)Cc2ccccc2N1.
What is the InChIKey of 2,2-dimethyl-1,3-dihydroindole;ethane?
The InChIKey is CZRLTEAMJXPLKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N.C2H6/c1-10(2)7-8-5-3-4-6-9(8)11-10;1-2/h3-6,11H,7H2,1-2H3;1-2H3.
What are the key properties of 2,2-dimethyl-1,3-dihydroindole;ethane?
2,2-dimethyl-1,3-dihydroindole;ethane has a molecular weight of 177.29 g/mol, XLogP of 3.46, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,3-dihydroindole;ethane is sourced from PubChem (CID 90930598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).