C22H25F3N2O5S — CID 90930725
1-[2-(2-methoxyethoxy)phenyl]sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine (PubChem CID 90930725) has the molecular formula C22H25F3N2O5S and a molecular weight of 486.51 g/mol. Its IUPAC name is 1-[2-(2-methoxyethoxy)phenyl]sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine.
| Compound Name | 1-[2-(2-methoxyethoxy)phenyl]sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine |
|---|---|
| PubChem CID | 90930725 |
| Molecular Formula | C22H25F3N2O5S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 1-[2-(2-methoxyethoxy)phenyl]sulfonyl-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine |
| SMILES | COCCOc1ccccc1S(=O)(=O)N1CC=C(NOCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H25F3N2O5S/c1-30-13-14-31-20-7-2-3-8-21(20)33(28,29)27-11-9-19(10-12-27)26-32-16-17-5-4-6-18(15-17)22(23,24)25/h2-9,15,26H,10-14,16H2,1H3 |
| InChIKey | AOUYFDAVLLUSMY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|