C28H24N6O5 — CID 90931088
4-[(4R,5S,7R)-1,3,5-trihydroxy-4-methyl-7-[2-(9-methylpurin-8-yl)oxyethyl]-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 90931088) has the molecular formula C28H24N6O5 and a molecular weight of 524.54 g/mol. Its IUPAC name is 4-[(4R,5S,7R)-1,3,5-trihydroxy-4-methyl-7-[2-(9-methylpurin-8-yl)oxyethyl]-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(4R,5S,7R)-1,3,5-trihydroxy-4-methyl-7-[2-(9-methylpurin-8-yl)oxyethyl]-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 90931088 |
| Molecular Formula | C28H24N6O5 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 4-[(4R,5S,7R)-1,3,5-trihydroxy-4-methyl-7-[2-(9-methylpurin-8-yl)oxyethyl]-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | Cn1c(OCC[C@]23C[C@H](O)[C@](C)(O2)c2c3c(O)n(-c3ccc(C#N)c4ccccc34)c2O)nc2cncnc21 |
| InChI | InChI=1S/C28H24N6O5/c1-27-20(35)11-28(39-27,9-10-38-26-32-18-13-30-14-31-23(18)33(26)2)22-21(27)24(36)34(25(22)37)19-8-7-15(12-29)16-5-3-4-6-17(16)19/h3-8,13-14,20,35-37H,9-11H2,1-2H3/t20-,27-,28+/m0/s1 |
| InChIKey | UTDXTOSKLYVZQT-XNZIZSAOSA-N |
| XLogP | 3.26 |
| TPSA | 151.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |