C8H12O5 — CID 90931711
3,4-dihydroxy-5-methoxy-3-methylcyclohexane-1,2-dione (PubChem CID 90931711) has the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. Its IUPAC name is 3,4-dihydroxy-5-methoxy-3-methylcyclohexane-1,2-dione.
| Compound Name | 3,4-dihydroxy-5-methoxy-3-methylcyclohexane-1,2-dione |
|---|---|
| PubChem CID | 90931711 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 3,4-dihydroxy-5-methoxy-3-methylcyclohexane-1,2-dione |
| SMILES | COC1CC(=O)C(=O)C(C)(O)C1O |
| InChI | InChI=1S/C8H12O5/c1-8(12)6(10)4(9)3-5(13-2)7(8)11/h5,7,11-12H,3H2,1-2H3 |
| InChIKey | UPHPJXHZGKEFFK-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|