About 3-[3-[(4,4-difluorocyclohexyl)methylsulfonyl]phenyl]butan-1-amine
3-[3-[(4,4-difluorocyclohexyl)methylsulfonyl]phenyl]butan-1-amine (PubChem CID 90931918) has the molecular formula C17H25F2NO2S
and a molecular weight of 345.46 g/mol. Its IUPAC name is 3-[3-[(4,4-difluorocyclohexyl)methylsulfonyl]phenyl]butan-1-amine.
Molecular Properties
| Compound Name | 3-[3-[(4,4-difluorocyclohexyl)methylsulfonyl]phenyl]butan-1-amine |
| PubChem CID | 90931918 |
| Molecular Formula | C17H25F2NO2S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-[3-[(4,4-difluorocyclohexyl)methylsulfonyl]phenyl]butan-1-amine |
| SMILES | CC(CCN)c1cccc(S(=O)(=O)CC2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C17H25F2NO2S/c1-13(7-10-20)15-3-2-4-16(11-15)23(21,22)12-14-5-8-17(18,19)9-6-14/h2-4,11,13-14H,5-10,12,20H2,1H3 |
| InChIKey | SMHPTDHRLHLHRS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-[(4,4-difluorocyclohexyl)methylsulfonyl]phenyl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[(4,4-difluorocyclohexyl)methylsulfonyl]phenyl]butan-1-amine?
The IUPAC name of 3-[3-[(4,4-difluorocyclohexyl)methylsulfonyl]phenyl]butan-1-amine (CID 90931918) is 3-[3-[(4,4-difluorocyclohexyl)methylsulfonyl]phenyl]butan-1-amine.
What is the SMILES notation for 3-[3-[(4,4-difluorocyclohexyl)methylsulfonyl]phenyl]butan-1-amine?
The canonical SMILES for 3-[3-[(4,4-difluorocyclohexyl)methylsulfonyl]phenyl]butan-1-amine is CC(CCN)c1cccc(S(=O)(=O)CC2CCC(F)(F)CC2)c1.
What is the InChIKey of 3-[3-[(4,4-difluorocyclohexyl)methylsulfonyl]phenyl]butan-1-amine?
The InChIKey is SMHPTDHRLHLHRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F2NO2S/c1-13(7-10-20)15-3-2-4-16(11-15)23(21,22)12-14-5-8-17(18,19)9-6-14/h2-4,11,13-14H,5-10,12,20H2,1H3.
What are the key properties of 3-[3-[(4,4-difluorocyclohexyl)methylsulfonyl]phenyl]butan-1-amine?
3-[3-[(4,4-difluorocyclohexyl)methylsulfonyl]phenyl]butan-1-amine has a molecular weight of 345.46 g/mol, XLogP of 3.74, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[(4,4-difluorocyclohexyl)methylsulfonyl]phenyl]butan-1-amine is sourced from PubChem (CID 90931918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).