C23H12Cl12N6 — CID 90932062
2-(4-methylphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine;2-phenyl-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 90932062) has the molecular formula C23H12Cl12N6 and a molecular weight of 797.83 g/mol. Its IUPAC name is 2-(4-methylphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine;2-phenyl-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-(4-methylphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine;2-phenyl-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 90932062 |
| Molecular Formula | C23H12Cl12N6 |
| Molecular Weight | 797.83 g/mol |
| Exact Mass | 791.74 |
| IUPAC Name | 2-(4-methylphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine;2-phenyl-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | Cc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1.ClC(Cl)(Cl)c1nc(-c2ccccc2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C12H7Cl6N3.C11H5Cl6N3/c1-6-2-4-7(5-3-6)8-19-9(11(13,14)15)21-10(20-8)12(16,17)18;12-10(13,14)8-18-7(6-4-2-1-3-5-6)19-9(20-8)11(15,16)17/h2-5H,1H3;1-5H |
| InChIKey | WPMKGYFVBVYQES-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.83 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|