C27H30N2O5 — CID 90932449
(6E,10E)-4,16,18-trimethyl-12-[(4-nitrophenyl)methoxyimino]-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one (PubChem CID 90932449) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is (6E,10E)-4,16,18-trimethyl-12-[(4-nitrophenyl)methoxyimino]-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one.
| Compound Name | (6E,10E)-4,16,18-trimethyl-12-[(4-nitrophenyl)methoxyimino]-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one |
|---|---|
| PubChem CID | 90932449 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | (6E,10E)-4,16,18-trimethyl-12-[(4-nitrophenyl)methoxyimino]-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one |
| SMILES | Cc1cc(C)c2c(c1)CC(=NOCc1ccc([N+](=O)[O-])cc1)/C=C/CC/C=C/CC(C)OC2=O |
| InChI | InChI=1S/C27H30N2O5/c1-19-15-20(2)26-23(16-19)17-24(10-8-6-4-5-7-9-21(3)34-27(26)30)28-33-18-22-11-13-25(14-12-22)29(31)32/h5,7-8,10-16,21H,4,6,9,17-18H2,1-3H3/b7-5+,10-8+,28-24? |
| InChIKey | DWNHPFPNIPDNQY-JCGHAEPSSA-N |
| XLogP | 6.17 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|