C24H45N9 — CID 90932539
2,10,18,25,27,28,30,31,33-nonazaheptacyclo[17.5.3.33,9.311,17.022,26.06,32.014,29]tritriacontane (PubChem CID 90932539) has the molecular formula C24H45N9 and a molecular weight of 459.69 g/mol. Its IUPAC name is 2,10,18,25,27,28,30,31,33-nonazaheptacyclo[17.5.3.33,9.311,17.022,26.06,32.014,29]tritriacontane.
| Compound Name | 2,10,18,25,27,28,30,31,33-nonazaheptacyclo[17.5.3.33,9.311,17.022,26.06,32.014,29]tritriacontane |
|---|---|
| PubChem CID | 90932539 |
| Molecular Formula | C24H45N9 |
| Molecular Weight | 459.69 g/mol |
| Exact Mass | 459.38 |
| IUPAC Name | 2,10,18,25,27,28,30,31,33-nonazaheptacyclo[17.5.3.33,9.311,17.022,26.06,32.014,29]tritriacontane |
| SMILES | C1CC2CCC3NC4CCC5CCC(NC6CCC7CCC(NC1NC2N3)NC7N6)NC5N4 |
| InChI | InChI=1S/C24H45N9/c1-7-16-25-18-9-3-14-5-11-20(32-23(14)30-18)27-21-12-6-15-4-10-19(31-24(15)33-21)26-17-8-2-13(1)22(28-16)29-17/h13-33H,1-12H2 |
| InChIKey | GTUGQBQEBICHMN-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.69 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |