C20H23NO4 — CID 90932591
4-[3-(3-phenylprop-2-enoxy)propyl]-1a,2,6,6a-tetrahydrooxireno[2,3-f]isoindole-3,5-diol (PubChem CID 90932591) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-[3-(3-phenylprop-2-enoxy)propyl]-1a,2,6,6a-tetrahydrooxireno[2,3-f]isoindole-3,5-diol.
| Compound Name | 4-[3-(3-phenylprop-2-enoxy)propyl]-1a,2,6,6a-tetrahydrooxireno[2,3-f]isoindole-3,5-diol |
|---|---|
| PubChem CID | 90932591 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 4-[3-(3-phenylprop-2-enoxy)propyl]-1a,2,6,6a-tetrahydrooxireno[2,3-f]isoindole-3,5-diol |
| SMILES | Oc1c2c(c(O)n1CCCOCC=Cc1ccccc1)CC1OC1C2 |
| InChI | InChI=1S/C20H23NO4/c22-19-15-12-17-18(25-17)13-16(15)20(23)21(19)9-5-11-24-10-4-8-14-6-2-1-3-7-14/h1-4,6-8,17-18,22-23H,5,9-13H2 |
| InChIKey | XICPGRXWDRNBAR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|