C22H23F3N6O2S — CID 90932792
8-[3-[[4-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-2-(trifluoromethyl)-7,8,9,10-tetrahydro-6H-[1,3]oxazolo[4,5-g][1]benzazepine (PubChem CID 90932792) has the molecular formula C22H23F3N6O2S and a molecular weight of 492.53 g/mol. Its IUPAC name is 8-[3-[[4-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-2-(trifluoromethyl)-7,8,9,10-tetrahydro-6H-[1,3]oxazolo[4,5-g][1]benzazepine.
| Compound Name | 8-[3-[[4-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-2-(trifluoromethyl)-7,8,9,10-tetrahydro-6H-[1,3]oxazolo[4,5-g][1]benzazepine |
|---|---|
| PubChem CID | 90932792 |
| Molecular Formula | C22H23F3N6O2S |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 8-[3-[[4-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-2-(trifluoromethyl)-7,8,9,10-tetrahydro-6H-[1,3]oxazolo[4,5-g][1]benzazepine |
| SMILES | Cc1ncoc1-c1nnc(SCCCC2CCc3c(ccc4oc(C(F)(F)F)nc34)NC2)n1C |
| InChI | InChI=1S/C22H23F3N6O2S/c1-12-18(32-11-27-12)19-29-30-21(31(19)2)34-9-3-4-13-5-6-14-15(26-10-13)7-8-16-17(14)28-20(33-16)22(23,24)25/h7-8,11,13,26H,3-6,9-10H2,1-2H3 |
| InChIKey | IWMTXCYOFBBYFO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|