About bicyclo[3.2.2]nona-1(7),3-diene
bicyclo[3.2.2]nona-1(7),3-diene (PubChem CID 90933303) has the molecular formula C9H12
and a molecular weight of 120.19 g/mol. Its IUPAC name is bicyclo[3.2.2]nona-1(7),3-diene.
Molecular Properties
| Compound Name | bicyclo[3.2.2]nona-1(7),3-diene |
| PubChem CID | 90933303 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | bicyclo[3.2.2]nona-1(7),3-diene |
| SMILES | C1=CC2CC=C(C1)CC2 |
| InChI | InChI=1S/C9H12/c1-2-8-4-6-9(3-1)7-5-8/h1-2,6,8H,3-5,7H2 |
| InChIKey | OXIKPBKYGSINFO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[3.2.2]nona-1(7),3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.2.2]nona-1(7),3-diene?
The IUPAC name of bicyclo[3.2.2]nona-1(7),3-diene (CID 90933303) is bicyclo[3.2.2]nona-1(7),3-diene.
What is the SMILES notation for bicyclo[3.2.2]nona-1(7),3-diene?
The canonical SMILES for bicyclo[3.2.2]nona-1(7),3-diene is C1=CC2CC=C(C1)CC2.
What is the InChIKey of bicyclo[3.2.2]nona-1(7),3-diene?
The InChIKey is OXIKPBKYGSINFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12/c1-2-8-4-6-9(3-1)7-5-8/h1-2,6,8H,3-5,7H2.
What are the key properties of bicyclo[3.2.2]nona-1(7),3-diene?
bicyclo[3.2.2]nona-1(7),3-diene has a molecular weight of 120.19 g/mol, XLogP of 2.67, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.2.2]nona-1(7),3-diene is sourced from PubChem (CID 90933303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).