C22H16F3N3O6S — CID 90933322
(5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-[4-(trifluoromethylsulfonyl)phenyl]ethynyl]imidazolidine-2,4-dione (PubChem CID 90933322) has the molecular formula C22H16F3N3O6S and a molecular weight of 507.45 g/mol. Its IUPAC name is (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-[4-(trifluoromethylsulfonyl)phenyl]ethynyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-[4-(trifluoromethylsulfonyl)phenyl]ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90933322 |
| Molecular Formula | C22H16F3N3O6S |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 507.07 |
| IUPAC Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-[4-(trifluoromethylsulfonyl)phenyl]ethynyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(C[C@@]3(C#Cc4ccc(S(=O)(=O)C(F)(F)F)cc4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C22H16F3N3O6S/c1-34-15-5-4-14-11-28(18(29)17(14)10-15)12-21(19(30)26-20(31)27-21)9-8-13-2-6-16(7-3-13)35(32,33)22(23,24)25/h2-7,10-11,29H,12H2,1H3,(H2,26,27,30,31)/t21-/m1/s1 |
| InChIKey | FGKPXCMHEJZBDE-OAQYLSRUSA-N |
| XLogP | 2.28 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|