C34H66O4Si2 — CID 90933558
(2R,3R,4S,8S,9R,10R,12S)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,8,10,12-hexamethylhexadeca-5,13,15-trienoic acid (PubChem CID 90933558) has the molecular formula C34H66O4Si2 and a molecular weight of 595.07 g/mol. Its IUPAC name is (2R,3R,4S,8S,9R,10R,12S)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,8,10,12-hexamethylhexadeca-5,13,15-trienoic acid.
| Compound Name | (2R,3R,4S,8S,9R,10R,12S)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,8,10,12-hexamethylhexadeca-5,13,15-trienoic acid |
|---|---|
| PubChem CID | 90933558 |
| Molecular Formula | C34H66O4Si2 |
| Molecular Weight | 595.07 g/mol |
| Exact Mass | 594.45 |
| IUPAC Name | (2R,3R,4S,8S,9R,10R,12S)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,8,10,12-hexamethylhexadeca-5,13,15-trienoic acid |
| SMILES | C=CC=C[C@@H](C)C[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CC(C)=C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C34H66O4Si2/c1-18-19-20-24(2)21-26(4)30(37-39(14,15)33(8,9)10)27(5)22-25(3)23-28(6)31(29(7)32(35)36)38-40(16,17)34(11,12)13/h18-20,23-24,26-31H,1,21-22H2,2-17H3,(H,35,36)/t24-,26-,27+,28+,29-,30-,31-/m1/s1 |
| InChIKey | NKTOCYPDFUEWAF-SWFNXQAFSA-N |
| XLogP | 10.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.07 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|