C12H14FNO2 — CID 90933961
1-(4-fluoro-3-methylphenyl)-5-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 90933961) has the molecular formula C12H14FNO2 and a molecular weight of 223.25 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)-5-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | 1-(4-fluoro-3-methylphenyl)-5-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 90933961 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)-5-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | Cc1cc(N2C(=O)CCC2CO)ccc1F |
| InChI | InChI=1S/C12H14FNO2/c1-8-6-9(2-4-11(8)13)14-10(7-15)3-5-12(14)16/h2,4,6,10,15H,3,5,7H2,1H3 |
| InChIKey | VDTIOONPFGVFNR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |