C34H39FN6O3 — CID 90934611
2-[(2S,3S,5R)-3-azido-6-(4-fluoroanilino)-5-methyl-6-oxo-1-phenylhexan-2-yl]-3-hydroxy-N,N-dipropylisoindole-5-carboxamide (PubChem CID 90934611) has the molecular formula C34H39FN6O3 and a molecular weight of 598.72 g/mol. Its IUPAC name is 2-[(2S,3S,5R)-3-azido-6-(4-fluoroanilino)-5-methyl-6-oxo-1-phenylhexan-2-yl]-3-hydroxy-N,N-dipropylisoindole-5-carboxamide.
| Compound Name | 2-[(2S,3S,5R)-3-azido-6-(4-fluoroanilino)-5-methyl-6-oxo-1-phenylhexan-2-yl]-3-hydroxy-N,N-dipropylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 90934611 |
| Molecular Formula | C34H39FN6O3 |
| Molecular Weight | 598.72 g/mol |
| Exact Mass | 598.31 |
| IUPAC Name | 2-[(2S,3S,5R)-3-azido-6-(4-fluoroanilino)-5-methyl-6-oxo-1-phenylhexan-2-yl]-3-hydroxy-N,N-dipropylisoindole-5-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccc2cn([C@@H](Cc3ccccc3)[C@H](C[C@@H](C)C(=O)Nc3ccc(F)cc3)N=[N+]=[N-])c(O)c2c1 |
| InChI | InChI=1S/C34H39FN6O3/c1-4-17-40(18-5-2)33(43)25-11-12-26-22-41(34(44)29(26)21-25)31(20-24-9-7-6-8-10-24)30(38-39-36)19-23(3)32(42)37-28-15-13-27(35)14-16-28/h6-16,21-23,30-31,44H,4-5,17-20H2,1-3H3,(H,37,42)/t23-,30+,31+/m1/s1 |
| InChIKey | CXEMLEZWOVFWNK-VBDKILDKSA-N |
| XLogP | 7.88 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.72 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|