C13H24N4O — CID 90934811
(2R)-1-azido-3-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]propan-2-ol (PubChem CID 90934811) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is (2R)-1-azido-3-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]propan-2-ol.
| Compound Name | (2R)-1-azido-3-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]propan-2-ol |
|---|---|
| PubChem CID | 90934811 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | (2R)-1-azido-3-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]propan-2-ol |
| SMILES | CC1(C)C[C@@H]2C[C@@](C)(CN2C[C@@H](O)CN=[N+]=[N-])C1 |
| InChI | InChI=1S/C13H24N4O/c1-12(2)4-10-5-13(3,8-12)9-17(10)7-11(18)6-15-16-14/h10-11,18H,4-9H2,1-3H3/t10-,11+,13-/m1/s1 |
| InChIKey | CQASXPQTVMQRHY-NTZNESFSSA-N |
| XLogP | 2.56 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|