About (3S)-3-benzyl-2-(cyclopropylmethyl)-3-methyl-1,4,2-dioxazolidine
(3S)-3-benzyl-2-(cyclopropylmethyl)-3-methyl-1,4,2-dioxazolidine (PubChem CID 90934999) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is (3S)-3-benzyl-2-(cyclopropylmethyl)-3-methyl-1,4,2-dioxazolidine.
Molecular Properties
| Compound Name | (3S)-3-benzyl-2-(cyclopropylmethyl)-3-methyl-1,4,2-dioxazolidine |
| PubChem CID | 90934999 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (3S)-3-benzyl-2-(cyclopropylmethyl)-3-methyl-1,4,2-dioxazolidine |
| SMILES | C[C@@]1(Cc2ccccc2)OCON1CC1CC1 |
| InChI | InChI=1S/C14H19NO2/c1-14(9-12-5-3-2-4-6-12)15(17-11-16-14)10-13-7-8-13/h2-6,13H,7-11H2,1H3/t14-/m0/s1 |
| InChIKey | QVDAQPISUNCYSN-AWEZNQCLSA-N |
| XLogP | 2.58 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-benzyl-2-(cyclopropylmethyl)-3-methyl-1,4,2-dioxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-benzyl-2-(cyclopropylmethyl)-3-methyl-1,4,2-dioxazolidine?
The IUPAC name of (3S)-3-benzyl-2-(cyclopropylmethyl)-3-methyl-1,4,2-dioxazolidine (CID 90934999) is (3S)-3-benzyl-2-(cyclopropylmethyl)-3-methyl-1,4,2-dioxazolidine.
What is the SMILES notation for (3S)-3-benzyl-2-(cyclopropylmethyl)-3-methyl-1,4,2-dioxazolidine?
The canonical SMILES for (3S)-3-benzyl-2-(cyclopropylmethyl)-3-methyl-1,4,2-dioxazolidine is C[C@@]1(Cc2ccccc2)OCON1CC1CC1.
What is the InChIKey of (3S)-3-benzyl-2-(cyclopropylmethyl)-3-methyl-1,4,2-dioxazolidine?
The InChIKey is QVDAQPISUNCYSN-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H19NO2/c1-14(9-12-5-3-2-4-6-12)15(17-11-16-14)10-13-7-8-13/h2-6,13H,7-11H2,1H3/t14-/m0/s1.
What are the key properties of (3S)-3-benzyl-2-(cyclopropylmethyl)-3-methyl-1,4,2-dioxazolidine?
(3S)-3-benzyl-2-(cyclopropylmethyl)-3-methyl-1,4,2-dioxazolidine has a molecular weight of 233.31 g/mol, XLogP of 2.58, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-benzyl-2-(cyclopropylmethyl)-3-methyl-1,4,2-dioxazolidine is sourced from PubChem (CID 90934999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).