About 2-(3-ethyl-5-methyl-5H-1,2,4-oxadiazol-4-yl)ethanol
2-(3-ethyl-5-methyl-5H-1,2,4-oxadiazol-4-yl)ethanol (PubChem CID 90935186) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-(3-ethyl-5-methyl-5H-1,2,4-oxadiazol-4-yl)ethanol.
Analyze 2-(3-ethyl-5-methyl-5H-1,2,4-oxadiazol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-5-methyl-5H-1,2,4-oxadiazol-4-yl)ethanol?
The IUPAC name of 2-(3-ethyl-5-methyl-5H-1,2,4-oxadiazol-4-yl)ethanol (CID 90935186) is 2-(3-ethyl-5-methyl-5H-1,2,4-oxadiazol-4-yl)ethanol.
What is the SMILES notation for 2-(3-ethyl-5-methyl-5H-1,2,4-oxadiazol-4-yl)ethanol?
The canonical SMILES for 2-(3-ethyl-5-methyl-5H-1,2,4-oxadiazol-4-yl)ethanol is CCC1=NOC(C)N1CCO.
What is the InChIKey of 2-(3-ethyl-5-methyl-5H-1,2,4-oxadiazol-4-yl)ethanol?
The InChIKey is XSXUJPVSSZZUCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-3-7-8-11-6(2)9(7)4-5-10/h6,10H,3-5H2,1-2H3.
What are the key properties of 2-(3-ethyl-5-methyl-5H-1,2,4-oxadiazol-4-yl)ethanol?
2-(3-ethyl-5-methyl-5H-1,2,4-oxadiazol-4-yl)ethanol has a molecular weight of 158.20 g/mol, XLogP of 0.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-5-methyl-5H-1,2,4-oxadiazol-4-yl)ethanol is sourced from PubChem (CID 90935186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).