C24H23ClN2O5S2 — CID 90935275
[[2-(2-benzyl-4-methoxyphenyl)sulfanylacetyl]amino] (6S)-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 90935275) has the molecular formula C24H23ClN2O5S2 and a molecular weight of 519.04 g/mol. Its IUPAC name is [[2-(2-benzyl-4-methoxyphenyl)sulfanylacetyl]amino] (6S)-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | [[2-(2-benzyl-4-methoxyphenyl)sulfanylacetyl]amino] (6S)-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 90935275 |
| Molecular Formula | C24H23ClN2O5S2 |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | [[2-(2-benzyl-4-methoxyphenyl)sulfanylacetyl]amino] (6S)-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COc1ccc(SCC(=O)NOC(=O)C2=C(CCl)CS[C@H]3CC(=O)N23)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H23ClN2O5S2/c1-31-18-7-8-19(16(10-18)9-15-5-3-2-4-6-15)33-14-20(28)26-32-24(30)23-17(12-25)13-34-22-11-21(29)27(22)23/h2-8,10,22H,9,11-14H2,1H3,(H,26,28)/t22-/m0/s1 |
| InChIKey | OSDZFHRXEOGPQX-QFIPXVFZSA-N |
| XLogP | 3.75 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|