About 2'-butyl-5-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one
2'-butyl-5-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 90935335) has the molecular formula C14H16ClNO
and a molecular weight of 249.74 g/mol. Its IUPAC name is 2'-butyl-5-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one.
Molecular Properties
| Compound Name | 2'-butyl-5-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one |
| PubChem CID | 90935335 |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 2'-butyl-5-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | CCCCC1CC12C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C14H16ClNO/c1-2-3-4-9-8-14(9)11-7-10(15)5-6-12(11)16-13(14)17/h5-7,9H,2-4,8H2,1H3,(H,16,17) |
| InChIKey | BGHZSGMTGBODRY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2'-butyl-5-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-butyl-5-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one?
The IUPAC name of 2'-butyl-5-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one (CID 90935335) is 2'-butyl-5-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one.
What is the SMILES notation for 2'-butyl-5-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one?
The canonical SMILES for 2'-butyl-5-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one is CCCCC1CC12C(=O)Nc1ccc(Cl)cc12.
What is the InChIKey of 2'-butyl-5-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one?
The InChIKey is BGHZSGMTGBODRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClNO/c1-2-3-4-9-8-14(9)11-7-10(15)5-6-12(11)16-13(14)17/h5-7,9H,2-4,8H2,1H3,(H,16,17).
What are the key properties of 2'-butyl-5-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one?
2'-butyl-5-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one has a molecular weight of 249.74 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-butyl-5-chlorospiro[1H-indole-3,1'-cyclopropane]-2-one is sourced from PubChem (CID 90935335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).