C14H19N3S — CID 90935667
N-methyl-N'-[5-(3-methylphenyl)-1,3-thiazol-2-yl]propane-1,3-diamine (PubChem CID 90935667) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is N-methyl-N'-[5-(3-methylphenyl)-1,3-thiazol-2-yl]propane-1,3-diamine.
| Compound Name | N-methyl-N'-[5-(3-methylphenyl)-1,3-thiazol-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 90935667 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-methyl-N'-[5-(3-methylphenyl)-1,3-thiazol-2-yl]propane-1,3-diamine |
| SMILES | CNCCCNc1ncc(-c2cccc(C)c2)s1 |
| InChI | InChI=1S/C14H19N3S/c1-11-5-3-6-12(9-11)13-10-17-14(18-13)16-8-4-7-15-2/h3,5-6,9-10,15H,4,7-8H2,1-2H3,(H,16,17) |
| InChIKey | XWGRVWBJQAWBPJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|