C25H30N2O4S — CID 90935957
4-[(1,2-dimethylindol-3-yl)methyl]-N-(4-methoxyphenyl)aniline;trihydroxy(methyl)-λ4-sulfane (PubChem CID 90935957) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is 4-[(1,2-dimethylindol-3-yl)methyl]-N-(4-methoxyphenyl)aniline;trihydroxy(methyl)-λ4-sulfane.
| Compound Name | 4-[(1,2-dimethylindol-3-yl)methyl]-N-(4-methoxyphenyl)aniline;trihydroxy(methyl)-λ4-sulfane |
|---|---|
| PubChem CID | 90935957 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 4-[(1,2-dimethylindol-3-yl)methyl]-N-(4-methoxyphenyl)aniline;trihydroxy(methyl)-λ4-sulfane |
| SMILES | COc1ccc(Nc2ccc(Cc3c(C)n(C)c4ccccc34)cc2)cc1.CS(O)(O)O |
| InChI | InChI=1S/C24H24N2O.CH6O3S/c1-17-23(22-6-4-5-7-24(22)26(17)2)16-18-8-10-19(11-9-18)25-20-12-14-21(27-3)15-13-20;1-5(2,3)4/h4-15,25H,16H2,1-3H3;2-4H,1H3 |
| InChIKey | KFYJYJFYPVROPF-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|