C21H30N8O — CID 90936001
2-N-(4-aminocyclohexyl)-6-N-[(2-amino-3-methoxyphenyl)methyl]-9-ethylpurine-2,6-diamine (PubChem CID 90936001) has the molecular formula C21H30N8O and a molecular weight of 410.53 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-6-N-[(2-amino-3-methoxyphenyl)methyl]-9-ethylpurine-2,6-diamine.
| Compound Name | 2-N-(4-aminocyclohexyl)-6-N-[(2-amino-3-methoxyphenyl)methyl]-9-ethylpurine-2,6-diamine |
|---|---|
| PubChem CID | 90936001 |
| Molecular Formula | C21H30N8O |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-6-N-[(2-amino-3-methoxyphenyl)methyl]-9-ethylpurine-2,6-diamine |
| SMILES | CCn1cnc2c(NCc3cccc(OC)c3N)nc(NC3CCC(N)CC3)nc21 |
| InChI | InChI=1S/C21H30N8O/c1-3-29-12-25-18-19(24-11-13-5-4-6-16(30-2)17(13)23)27-21(28-20(18)29)26-15-9-7-14(22)8-10-15/h4-6,12,14-15H,3,7-11,22-23H2,1-2H3,(H2,24,26,27,28) |
| InChIKey | AAEQEUWBBXKUJC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 128.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|