C24H19ClFNO8S2 — CID 90936009
(2-oxooxolan-3-yl) 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate (PubChem CID 90936009) has the molecular formula C24H19ClFNO8S2 and a molecular weight of 568.00 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate.
| Compound Name | (2-oxooxolan-3-yl) 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90936009 |
| Molecular Formula | C24H19ClFNO8S2 |
| Molecular Weight | 568.00 g/mol |
| Exact Mass | 567.02 |
| IUPAC Name | (2-oxooxolan-3-yl) 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate |
| SMILES | CC1=NC2=C(C(c3c(F)cccc3Cl)C1C(=O)OC1CCOC1=O)S(=O)(=O)c1ccccc1S(=O)(=O)C2 |
| InChI | InChI=1S/C24H19ClFNO8S2/c1-12-19(24(29)35-16-9-10-34-23(16)28)21(20-13(25)5-4-6-14(20)26)22-15(27-12)11-36(30,31)17-7-2-3-8-18(17)37(22,32)33/h2-8,16,19,21H,9-11H2,1H3 |
| InChIKey | HVJRDCWOZUCVFI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 133.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.00 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |