C30H46O3 — CID 90936094
trans-(1R,3S)-5-[2-[(3aS,7aR)-1-(7-ethyl-7-hydroxynon-3-yn-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 90936094) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is trans-(1R,3S)-5-[2-[(3aS,7aR)-1-(7-ethyl-7-hydroxynon-3-yn-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S)-5-[2-[(3aS,7aR)-1-(7-ethyl-7-hydroxynon-3-yn-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 90936094 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | trans-(1R,3S)-5-[2-[(3aS,7aR)-1-(7-ethyl-7-hydroxynon-3-yn-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C(C(C)C#CCCC(O)(CC)CC)CC[C@@H]23)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C30H46O3/c1-6-30(33,7-2)18-9-8-11-21(3)26-15-16-27-23(12-10-17-29(26,27)5)13-14-24-19-25(31)20-28(32)22(24)4/h13-14,21,25-28,31-33H,4,6-7,9-10,12,15-20H2,1-3,5H3/t21?,25-,26?,27+,28+,29-/m1/s1 |
| InChIKey | NZVVDVWTKZQJLY-DWMZVZJRSA-N |
| XLogP | 6.10 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|