C13H25FO2Si — CID 90936433
(4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-4-methylhex-2-enal (PubChem CID 90936433) has the molecular formula C13H25FO2Si and a molecular weight of 260.43 g/mol. Its IUPAC name is (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-4-methylhex-2-enal.
| Compound Name | (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-4-methylhex-2-enal |
|---|---|
| PubChem CID | 90936433 |
| Molecular Formula | C13H25FO2Si |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-4-methylhex-2-enal |
| SMILES | C[C@H](C=C(F)C=O)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H25FO2Si/c1-10(8-12(14)9-15)11(2)16-17(6,7)13(3,4)5/h8-11H,1-7H3/t10-,11+/m1/s1 |
| InChIKey | WSNBDLXOFMMUOY-MNOVXSKESA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|