C48H80O14 — CID 90936566
3-(2,3-dihydroxypropoxycarbonyl)-2-(2-octadeca-9,12-dienoyloxypropanoyloxy)icos-12-ene-1,2,20-tricarboxylic acid (PubChem CID 90936566) has the molecular formula C48H80O14 and a molecular weight of 881.15 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropoxycarbonyl)-2-(2-octadeca-9,12-dienoyloxypropanoyloxy)icos-12-ene-1,2,20-tricarboxylic acid.
| Compound Name | 3-(2,3-dihydroxypropoxycarbonyl)-2-(2-octadeca-9,12-dienoyloxypropanoyloxy)icos-12-ene-1,2,20-tricarboxylic acid |
|---|---|
| PubChem CID | 90936566 |
| Molecular Formula | C48H80O14 |
| Molecular Weight | 881.15 g/mol |
| Exact Mass | 880.55 |
| IUPAC Name | 3-(2,3-dihydroxypropoxycarbonyl)-2-(2-octadeca-9,12-dienoyloxypropanoyloxy)icos-12-ene-1,2,20-tricarboxylic acid |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OC(C)C(=O)OC(CC(=O)O)(C(=O)O)C(CCCCCCCCC=CCCCCCCCC(=O)O)C(=O)OCC(O)CO |
| InChI | InChI=1S/C48H80O14/c1-3-4-5-6-7-8-9-10-12-17-20-23-26-29-32-35-44(55)61-39(2)45(56)62-48(47(58)59,36-43(53)54)41(46(57)60-38-40(50)37-49)33-30-27-24-21-18-15-13-11-14-16-19-22-25-28-31-34-42(51)52/h7-8,10-12,14,39-41,49-50H,3-6,9,13,15-38H2,1-2H3,(H,51,52)(H,53,54)(H,58,59) |
| InChIKey | LPVNYJCYHPCCAA-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 231.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.15 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|