C20H32NO5P — CID 90936714
butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate (PubChem CID 90936714) has the molecular formula C20H32NO5P and a molecular weight of 397.45 g/mol. Its IUPAC name is butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate.
| Compound Name | butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90936714 |
| Molecular Formula | C20H32NO5P |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(NC(=O)C(C)(C)CC)cc1.CCC(C)P(O)O |
| InChI | InChI=1S/C16H21NO3.C4H11O2P/c1-6-16(4,5)15(19)17-12-7-9-13(10-8-12)20-14(18)11(2)3;1-3-4(2)7(5)6/h7-10H,2,6H2,1,3-5H3,(H,17,19);4-6H,3H2,1-2H3 |
| InChIKey | IAINLEZXTUQHSS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|