About butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate
butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate (PubChem CID 90936714) has the molecular formula C20H32NO5P
and a molecular weight of 397.45 g/mol. Its IUPAC name is butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate |
| PubChem CID | 90936714 |
| Molecular Formula | C20H32NO5P |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(NC(=O)C(C)(C)CC)cc1.CCC(C)P(O)O |
| InChI | InChI=1S/C16H21NO3.C4H11O2P/c1-6-16(4,5)15(19)17-12-7-9-13(10-8-12)20-14(18)11(2)3;1-3-4(2)7(5)6/h7-10H,2,6H2,1,3-5H3,(H,17,19);4-6H,3H2,1-2H3 |
| InChIKey | IAINLEZXTUQHSS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate?
The IUPAC name of butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate (CID 90936714) is butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate.
What is the SMILES notation for butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate?
The canonical SMILES for butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate is C=C(C)C(=O)Oc1ccc(NC(=O)C(C)(C)CC)cc1.CCC(C)P(O)O.
What is the InChIKey of butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate?
The InChIKey is IAINLEZXTUQHSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO3.C4H11O2P/c1-6-16(4,5)15(19)17-12-7-9-13(10-8-12)20-14(18)11(2)3;1-3-4(2)7(5)6/h7-10H,2,6H2,1,3-5H3,(H,17,19);4-6H,3H2,1-2H3.
What are the key properties of butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate?
butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate has a molecular weight of 397.45 g/mol, XLogP of 4.62, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylphosphonous acid;[4-(2,2-dimethylbutanoylamino)phenyl] 2-methylprop-2-enoate is sourced from PubChem (CID 90936714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).