About 1,6-diethylcyclohexa-1,4-diene
1,6-diethylcyclohexa-1,4-diene (PubChem CID 90936968) has the molecular formula C10H16
and a molecular weight of 136.24 g/mol. Its IUPAC name is 1,6-diethylcyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 1,6-diethylcyclohexa-1,4-diene |
| PubChem CID | 90936968 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 1,6-diethylcyclohexa-1,4-diene |
| SMILES | CCC1=CCC=CC1CC |
| InChI | InChI=1S/C10H16/c1-3-9-7-5-6-8-10(9)4-2/h5,7-9H,3-4,6H2,1-2H3 |
| InChIKey | ZIZDUOIVSHJDKS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,6-diethylcyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-diethylcyclohexa-1,4-diene?
The IUPAC name of 1,6-diethylcyclohexa-1,4-diene (CID 90936968) is 1,6-diethylcyclohexa-1,4-diene.
What is the SMILES notation for 1,6-diethylcyclohexa-1,4-diene?
The canonical SMILES for 1,6-diethylcyclohexa-1,4-diene is CCC1=CCC=CC1CC.
What is the InChIKey of 1,6-diethylcyclohexa-1,4-diene?
The InChIKey is ZIZDUOIVSHJDKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16/c1-3-9-7-5-6-8-10(9)4-2/h5,7-9H,3-4,6H2,1-2H3.
What are the key properties of 1,6-diethylcyclohexa-1,4-diene?
1,6-diethylcyclohexa-1,4-diene has a molecular weight of 136.24 g/mol, XLogP of 3.31, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-diethylcyclohexa-1,4-diene is sourced from PubChem (CID 90936968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).