About 4-ethyl-2,6-dimethyl-4H-thiopyran
4-ethyl-2,6-dimethyl-4H-thiopyran (PubChem CID 90937146) has the molecular formula C9H14S
and a molecular weight of 154.28 g/mol. Its IUPAC name is 4-ethyl-2,6-dimethyl-4H-thiopyran.
Molecular Properties
| Compound Name | 4-ethyl-2,6-dimethyl-4H-thiopyran |
| PubChem CID | 90937146 |
| Molecular Formula | C9H14S |
| Molecular Weight | 154.28 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 4-ethyl-2,6-dimethyl-4H-thiopyran |
| SMILES | CCC1C=C(C)SC(C)=C1 |
| InChI | InChI=1S/C9H14S/c1-4-9-5-7(2)10-8(3)6-9/h5-6,9H,4H2,1-3H3 |
| InChIKey | NJTJKXVSXJSIPO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethyl-2,6-dimethyl-4H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,6-dimethyl-4H-thiopyran?
The IUPAC name of 4-ethyl-2,6-dimethyl-4H-thiopyran (CID 90937146) is 4-ethyl-2,6-dimethyl-4H-thiopyran.
What is the SMILES notation for 4-ethyl-2,6-dimethyl-4H-thiopyran?
The canonical SMILES for 4-ethyl-2,6-dimethyl-4H-thiopyran is CCC1C=C(C)SC(C)=C1.
What is the InChIKey of 4-ethyl-2,6-dimethyl-4H-thiopyran?
The InChIKey is NJTJKXVSXJSIPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14S/c1-4-9-5-7(2)10-8(3)6-9/h5-6,9H,4H2,1-3H3.
What are the key properties of 4-ethyl-2,6-dimethyl-4H-thiopyran?
4-ethyl-2,6-dimethyl-4H-thiopyran has a molecular weight of 154.28 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,6-dimethyl-4H-thiopyran is sourced from PubChem (CID 90937146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).