About 2-tert-butyl-5-hexa-1,3-dienyl-5-methyl-1,3-oxathiolan-4-one
2-tert-butyl-5-hexa-1,3-dienyl-5-methyl-1,3-oxathiolan-4-one (PubChem CID 90937491) has the molecular formula C14H22O2S
and a molecular weight of 254.39 g/mol. Its IUPAC name is 2-tert-butyl-5-hexa-1,3-dienyl-5-methyl-1,3-oxathiolan-4-one.
Molecular Properties
| Compound Name | 2-tert-butyl-5-hexa-1,3-dienyl-5-methyl-1,3-oxathiolan-4-one |
| PubChem CID | 90937491 |
| Molecular Formula | C14H22O2S |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-tert-butyl-5-hexa-1,3-dienyl-5-methyl-1,3-oxathiolan-4-one |
| SMILES | CCC=CC=CC1(C)OC(C(C)(C)C)SC1=O |
| InChI | InChI=1S/C14H22O2S/c1-6-7-8-9-10-14(5)11(15)17-12(16-14)13(2,3)4/h7-10,12H,6H2,1-5H3 |
| InChIKey | SZCFSMLGRPXJSF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-5-hexa-1,3-dienyl-5-methyl-1,3-oxathiolan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-hexa-1,3-dienyl-5-methyl-1,3-oxathiolan-4-one?
The IUPAC name of 2-tert-butyl-5-hexa-1,3-dienyl-5-methyl-1,3-oxathiolan-4-one (CID 90937491) is 2-tert-butyl-5-hexa-1,3-dienyl-5-methyl-1,3-oxathiolan-4-one.
What is the SMILES notation for 2-tert-butyl-5-hexa-1,3-dienyl-5-methyl-1,3-oxathiolan-4-one?
The canonical SMILES for 2-tert-butyl-5-hexa-1,3-dienyl-5-methyl-1,3-oxathiolan-4-one is CCC=CC=CC1(C)OC(C(C)(C)C)SC1=O.
What is the InChIKey of 2-tert-butyl-5-hexa-1,3-dienyl-5-methyl-1,3-oxathiolan-4-one?
The InChIKey is SZCFSMLGRPXJSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2S/c1-6-7-8-9-10-14(5)11(15)17-12(16-14)13(2,3)4/h7-10,12H,6H2,1-5H3.
What are the key properties of 2-tert-butyl-5-hexa-1,3-dienyl-5-methyl-1,3-oxathiolan-4-one?
2-tert-butyl-5-hexa-1,3-dienyl-5-methyl-1,3-oxathiolan-4-one has a molecular weight of 254.39 g/mol, XLogP of 3.93, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-hexa-1,3-dienyl-5-methyl-1,3-oxathiolan-4-one is sourced from PubChem (CID 90937491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).