C11H17FN2O — CID 90937944
2-amino-7-fluoro-5-methyldeca-4,6,9-trienamide (PubChem CID 90937944) has the molecular formula C11H17FN2O and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-amino-7-fluoro-5-methyldeca-4,6,9-trienamide.
| Compound Name | 2-amino-7-fluoro-5-methyldeca-4,6,9-trienamide |
|---|---|
| PubChem CID | 90937944 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-amino-7-fluoro-5-methyldeca-4,6,9-trienamide |
| SMILES | C=CCC(F)=CC(C)=CCC(N)C(N)=O |
| InChI | InChI=1S/C11H17FN2O/c1-3-4-9(12)7-8(2)5-6-10(13)11(14)15/h3,5,7,10H,1,4,6,13H2,2H3,(H2,14,15) |
| InChIKey | IGKVRLCAQQFYGF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|