C54H58N4 — CID 90938006
2-[2,3,4,5-tetrakis(4-tert-butylphenyl)-6-pyrimidin-2-ylphenyl]pyrimidine (PubChem CID 90938006) has the molecular formula C54H58N4 and a molecular weight of 763.09 g/mol. Its IUPAC name is 2-[2,3,4,5-tetrakis(4-tert-butylphenyl)-6-pyrimidin-2-ylphenyl]pyrimidine.
| Compound Name | 2-[2,3,4,5-tetrakis(4-tert-butylphenyl)-6-pyrimidin-2-ylphenyl]pyrimidine |
|---|---|
| PubChem CID | 90938006 |
| Molecular Formula | C54H58N4 |
| Molecular Weight | 763.09 g/mol |
| Exact Mass | 762.47 |
| IUPAC Name | 2-[2,3,4,5-tetrakis(4-tert-butylphenyl)-6-pyrimidin-2-ylphenyl]pyrimidine |
| SMILES | CC(C)(C)c1ccc(-c2c(-c3ccc(C(C)(C)C)cc3)c(-c3ccc(C(C)(C)C)cc3)c(-c3ncccn3)c(-c3ncccn3)c2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C54H58N4/c1-51(2,3)39-23-15-35(16-24-39)43-44(36-17-25-40(26-18-36)52(4,5)6)46(38-21-29-42(30-22-38)54(10,11)12)48(50-57-33-14-34-58-50)47(49-55-31-13-32-56-49)45(43)37-19-27-41(28-20-37)53(7,8)9/h13-34H,1-12H3 |
| InChIKey | FSXZARZMQYQILA-UHFFFAOYSA-N |
| XLogP | 14.46 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.09 |
| LogP ≤ 5 | 14.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |