C27H21F3O9S — CID 90938015
[(2R,3R,4R,5R)-3,5-dibenzoyloxy-4-(trifluoromethylsulfonyl)oxolan-2-yl]methyl benzoate (PubChem CID 90938015) has the molecular formula C27H21F3O9S and a molecular weight of 578.52 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,5-dibenzoyloxy-4-(trifluoromethylsulfonyl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,5-dibenzoyloxy-4-(trifluoromethylsulfonyl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 90938015 |
| Molecular Formula | C27H21F3O9S |
| Molecular Weight | 578.52 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | [(2R,3R,4R,5R)-3,5-dibenzoyloxy-4-(trifluoromethylsulfonyl)oxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@H](OC(=O)c2ccccc2)[C@H](S(=O)(=O)C(F)(F)F)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H21F3O9S/c28-27(29,30)40(34,35)22-21(38-24(32)18-12-6-2-7-13-18)20(16-36-23(31)17-10-4-1-5-11-17)37-26(22)39-25(33)19-14-8-3-9-15-19/h1-15,20-22,26H,16H2/t20-,21-,22-,26-/m1/s1 |
| InChIKey | HJSBVCLLFPXJKR-PIXQIBFHSA-N |
| XLogP | 3.95 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|