C21H18FN7O2S — CID 90938234
[5-[4-[[3-(cyanomethylidene)-1,2-dihydroindol-5-yl]amino]-5-fluoropyrimidin-2-yl]iminocyclohex-3-en-1-ylidene]methanesulfonamide (PubChem CID 90938234) has the molecular formula C21H18FN7O2S and a molecular weight of 451.49 g/mol. Its IUPAC name is [5-[4-[[3-(cyanomethylidene)-1,2-dihydroindol-5-yl]amino]-5-fluoropyrimidin-2-yl]iminocyclohex-3-en-1-ylidene]methanesulfonamide.
| Compound Name | [5-[4-[[3-(cyanomethylidene)-1,2-dihydroindol-5-yl]amino]-5-fluoropyrimidin-2-yl]iminocyclohex-3-en-1-ylidene]methanesulfonamide |
|---|---|
| PubChem CID | 90938234 |
| Molecular Formula | C21H18FN7O2S |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | [5-[4-[[3-(cyanomethylidene)-1,2-dihydroindol-5-yl]amino]-5-fluoropyrimidin-2-yl]iminocyclohex-3-en-1-ylidene]methanesulfonamide |
| SMILES | N#CC=C1CNc2ccc(Nc3nc(N=C4C=CCC(=CS(N)(=O)=O)C4)ncc3F)cc21 |
| InChI | InChI=1S/C21H18FN7O2S/c22-18-11-26-21(28-15-3-1-2-13(8-15)12-32(24,30)31)29-20(18)27-16-4-5-19-17(9-16)14(6-7-23)10-25-19/h1,3-6,9,11-12,25H,2,8,10H2,(H2,24,30,31)(H,26,27,29) |
| InChIKey | NBEMKBYZDKYKEV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|