C15H9F3O4S — CID 90938710
2,4-dioxo-4-[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]butanoic acid (PubChem CID 90938710) has the molecular formula C15H9F3O4S and a molecular weight of 342.29 g/mol. Its IUPAC name is 2,4-dioxo-4-[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]butanoic acid.
| Compound Name | 2,4-dioxo-4-[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]butanoic acid |
|---|---|
| PubChem CID | 90938710 |
| Molecular Formula | C15H9F3O4S |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 2,4-dioxo-4-[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]butanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1ccc(-c2ccc(C(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C15H9F3O4S/c16-15(17,18)9-3-1-8(2-4-9)12-5-6-13(23-12)10(19)7-11(20)14(21)22/h1-6H,7H2,(H,21,22) |
| InChIKey | YQJTVNCSYYWBLS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|