About S-(hydrazinecarbonyl) benzenecarbothioate
S-(hydrazinecarbonyl) benzenecarbothioate (PubChem CID 90938948) has the molecular formula C8H8N2O2S
and a molecular weight of 196.23 g/mol. Its IUPAC name is S-(hydrazinecarbonyl) benzenecarbothioate.
Molecular Properties
| Compound Name | S-(hydrazinecarbonyl) benzenecarbothioate |
| PubChem CID | 90938948 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | S-(hydrazinecarbonyl) benzenecarbothioate |
| SMILES | NNC(=O)SC(=O)c1ccccc1 |
| InChI | InChI=1S/C8H8N2O2S/c9-10-8(12)13-7(11)6-4-2-1-3-5-6/h1-5H,9H2,(H,10,12) |
| InChIKey | MZPQROOYCREOTG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(hydrazinecarbonyl) benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(hydrazinecarbonyl) benzenecarbothioate?
The IUPAC name of S-(hydrazinecarbonyl) benzenecarbothioate (CID 90938948) is S-(hydrazinecarbonyl) benzenecarbothioate.
What is the SMILES notation for S-(hydrazinecarbonyl) benzenecarbothioate?
The canonical SMILES for S-(hydrazinecarbonyl) benzenecarbothioate is NNC(=O)SC(=O)c1ccccc1.
What is the InChIKey of S-(hydrazinecarbonyl) benzenecarbothioate?
The InChIKey is MZPQROOYCREOTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2S/c9-10-8(12)13-7(11)6-4-2-1-3-5-6/h1-5H,9H2,(H,10,12).
What are the key properties of S-(hydrazinecarbonyl) benzenecarbothioate?
S-(hydrazinecarbonyl) benzenecarbothioate has a molecular weight of 196.23 g/mol, XLogP of 1.14, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(hydrazinecarbonyl) benzenecarbothioate is sourced from PubChem (CID 90938948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).