C28H22Cl2F6N2O6S — CID 90939105
2-[2-[1-[3,5-bis(trifluoromethyl)benzoyl]-3-(3,4-dichlorophenyl)piperidin-3-yl]ethyl]-4-nitrobenzenesulfonic acid (PubChem CID 90939105) has the molecular formula C28H22Cl2F6N2O6S and a molecular weight of 699.45 g/mol. Its IUPAC name is 2-[2-[1-[3,5-bis(trifluoromethyl)benzoyl]-3-(3,4-dichlorophenyl)piperidin-3-yl]ethyl]-4-nitrobenzenesulfonic acid.
| Compound Name | 2-[2-[1-[3,5-bis(trifluoromethyl)benzoyl]-3-(3,4-dichlorophenyl)piperidin-3-yl]ethyl]-4-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 90939105 |
| Molecular Formula | C28H22Cl2F6N2O6S |
| Molecular Weight | 699.45 g/mol |
| Exact Mass | 698.05 |
| IUPAC Name | 2-[2-[1-[3,5-bis(trifluoromethyl)benzoyl]-3-(3,4-dichlorophenyl)piperidin-3-yl]ethyl]-4-nitrobenzenesulfonic acid |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCCC(CCc2cc([N+](=O)[O-])ccc2S(=O)(=O)O)(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C28H22Cl2F6N2O6S/c29-22-4-2-18(14-23(22)30)26(8-6-16-12-21(38(40)41)3-5-24(16)45(42,43)44)7-1-9-37(15-26)25(39)17-10-19(27(31,32)33)13-20(11-17)28(34,35)36/h2-5,10-14H,1,6-9,15H2,(H,42,43,44) |
| InChIKey | KJAVKBQPIWGJTL-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.45 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|