C35H41NO9 — CID 90939789
4-butoxycarbonyl-6-[[2,5-dihydroxy-4-methyl-1-[4-(2-phenylethynyl)phenyl]pyrrol-3-yl]methyl]-7-(2-hydroxyethoxy)-2-methyl-7-oxoheptanoic acid (PubChem CID 90939789) has the molecular formula C35H41NO9 and a molecular weight of 619.71 g/mol. Its IUPAC name is 4-butoxycarbonyl-6-[[2,5-dihydroxy-4-methyl-1-[4-(2-phenylethynyl)phenyl]pyrrol-3-yl]methyl]-7-(2-hydroxyethoxy)-2-methyl-7-oxoheptanoic acid.
| Compound Name | 4-butoxycarbonyl-6-[[2,5-dihydroxy-4-methyl-1-[4-(2-phenylethynyl)phenyl]pyrrol-3-yl]methyl]-7-(2-hydroxyethoxy)-2-methyl-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 90939789 |
| Molecular Formula | C35H41NO9 |
| Molecular Weight | 619.71 g/mol |
| Exact Mass | 619.28 |
| IUPAC Name | 4-butoxycarbonyl-6-[[2,5-dihydroxy-4-methyl-1-[4-(2-phenylethynyl)phenyl]pyrrol-3-yl]methyl]-7-(2-hydroxyethoxy)-2-methyl-7-oxoheptanoic acid |
| SMILES | CCCCOC(=O)C(CC(C)C(=O)O)CC(Cc1c(C)c(O)n(-c2ccc(C#Cc3ccccc3)cc2)c1O)C(=O)OCCO |
| InChI | InChI=1S/C35H41NO9/c1-4-5-18-44-34(42)27(20-23(2)33(40)41)21-28(35(43)45-19-17-37)22-30-24(3)31(38)36(32(30)39)29-15-13-26(14-16-29)12-11-25-9-7-6-8-10-25/h6-10,13-16,23,27-28,37-39H,4-5,17-22H2,1-3H3,(H,40,41) |
| InChIKey | JXBDGNYPEMVWGO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.71 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|