C22H32N8O8S2 — CID 90940240
N-[3-(5-amino-1,3,4-oxadiazol-2-yl)-4-methylphenyl]methanesulfonamide;aminourea;ethyl 5-(methanesulfonamido)-2-methylbenzoate (PubChem CID 90940240) has the molecular formula C22H32N8O8S2 and a molecular weight of 600.68 g/mol. Its IUPAC name is N-[3-(5-amino-1,3,4-oxadiazol-2-yl)-4-methylphenyl]methanesulfonamide;aminourea;ethyl 5-(methanesulfonamido)-2-methylbenzoate.
| Compound Name | N-[3-(5-amino-1,3,4-oxadiazol-2-yl)-4-methylphenyl]methanesulfonamide;aminourea;ethyl 5-(methanesulfonamido)-2-methylbenzoate |
|---|---|
| PubChem CID | 90940240 |
| Molecular Formula | C22H32N8O8S2 |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | N-[3-(5-amino-1,3,4-oxadiazol-2-yl)-4-methylphenyl]methanesulfonamide;aminourea;ethyl 5-(methanesulfonamido)-2-methylbenzoate |
| SMILES | CCOC(=O)c1cc(NS(C)(=O)=O)ccc1C.Cc1ccc(NS(C)(=O)=O)cc1-c1nnc(N)o1.NNC(N)=O |
| InChI | InChI=1S/C11H15NO4S.C10H12N4O3S.CH5N3O/c1-4-16-11(13)10-7-9(6-5-8(10)2)12-17(3,14)15;1-6-3-4-7(14-18(2,15)16)5-8(6)9-12-13-10(11)17-9;2-1(5)4-3/h5-7,12H,4H2,1-3H3;3-5,14H,1-2H3,(H2,11,13);3H2,(H3,2,4,5) |
| InChIKey | MMVXFZIINWZHQN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 264.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|