C24H25N9O — CID 90940261
2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-6-propan-2-yl-4-(quinolin-3-ylmethylamino)pyrrolo[3,4-d]pyrimidin-7-ol (PubChem CID 90940261) has the molecular formula C24H25N9O and a molecular weight of 455.53 g/mol. Its IUPAC name is 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-6-propan-2-yl-4-(quinolin-3-ylmethylamino)pyrrolo[3,4-d]pyrimidin-7-ol.
| Compound Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-6-propan-2-yl-4-(quinolin-3-ylmethylamino)pyrrolo[3,4-d]pyrimidin-7-ol |
|---|---|
| PubChem CID | 90940261 |
| Molecular Formula | C24H25N9O |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-6-propan-2-yl-4-(quinolin-3-ylmethylamino)pyrrolo[3,4-d]pyrimidin-7-ol |
| SMILES | CC(C)n1cc2c(NCc3cnc4ccccc4c3)nc(N3CCn4cnnc4C3)nc2c1O |
| InChI | InChI=1S/C24H25N9O/c1-15(2)33-12-18-21(23(33)34)28-24(31-7-8-32-14-27-30-20(32)13-31)29-22(18)26-11-16-9-17-5-3-4-6-19(17)25-10-16/h3-6,9-10,12,14-15,34H,7-8,11,13H2,1-2H3,(H,26,28,29) |
| InChIKey | PTXTVYZLVNLLJX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 109.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |