About butylsulfonyl-[cyclohexyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]oxidanium
butylsulfonyl-[cyclohexyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]oxidanium (PubChem CID 90940779) has the molecular formula C19H37O4S2+
and a molecular weight of 393.64 g/mol. Its IUPAC name is butylsulfonyl-[cyclohexyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]oxidanium.
Molecular Properties
| Compound Name | butylsulfonyl-[cyclohexyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]oxidanium |
| PubChem CID | 90940779 |
| Molecular Formula | C19H37O4S2+ |
| Molecular Weight | 393.64 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | butylsulfonyl-[cyclohexyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]oxidanium |
| SMILES | CCCCS(=O)(=O)[OH+]S(C)(CC(=O)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C19H36O4S2/c1-3-4-15-25(21,22)23-24(2,18-13-9-6-10-14-18)16-19(20)17-11-7-5-8-12-17/h17-18H,3-16H2,1-2H3/p+1 |
| InChIKey | WJHWCKRUDCWXTK-UHFFFAOYSA-O |
| XLogP | 5.04 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze butylsulfonyl-[cyclohexyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]oxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylsulfonyl-[cyclohexyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]oxidanium?
The IUPAC name of butylsulfonyl-[cyclohexyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]oxidanium (CID 90940779) is butylsulfonyl-[cyclohexyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]oxidanium.
What is the SMILES notation for butylsulfonyl-[cyclohexyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]oxidanium?
The canonical SMILES for butylsulfonyl-[cyclohexyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]oxidanium is CCCCS(=O)(=O)[OH+]S(C)(CC(=O)C1CCCCC1)C1CCCCC1.
What is the InChIKey of butylsulfonyl-[cyclohexyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]oxidanium?
The InChIKey is WJHWCKRUDCWXTK-UHFFFAOYSA-O. The full InChI is InChI=1S/C19H36O4S2/c1-3-4-15-25(21,22)23-24(2,18-13-9-6-10-14-18)16-19(20)17-11-7-5-8-12-17/h17-18H,3-16H2,1-2H3/p+1.
What are the key properties of butylsulfonyl-[cyclohexyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]oxidanium?
butylsulfonyl-[cyclohexyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]oxidanium has a molecular weight of 393.64 g/mol, XLogP of 5.04, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butylsulfonyl-[cyclohexyl-(2-cyclohexyl-2-oxoethyl)-methyl-λ4-sulfanyl]oxidanium is sourced from PubChem (CID 90940779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).